| Molecular Formula | C21H19NO4 |
| Molecular Weight | 383.82 |
| Synonyms | Broussonpapyrine Chloride |
| IUPAC Name | 1,2-dimethoxy-12-methyl-[1,3]benzodioxolo[5,6-c]phenanthridin-12-ium;chloride |
| Canonical SMILES | C[N+]1=C2C(=C3C=CC(=C(C3=C1)OC)OC)C=CC4=CC5=C(C=C42)OCO5.[Cl-] |
| InChI | InChI=1S/C21H18NO4.ClH/c1-22-10-16-13(6-7-17(23-2)21(16)24-3)14-5-4-12-8-18-19(26-11-25-18)9-15(12)20(14)22;/h4-10H,11H2,1-3H3;1H/q+1;/p-1 |
| InChI Key | WEEFNMFMNMASJY-UHFFFAOYSA-M |
| Boiling Point | 711.4°C at 760 mmHg |
| Melting Point | 172-180°C |
| Purity | >98% |
| Density | 1.36 g/cm3 |
| Solubility | Soluble in DMSO |
| Appearance | Yellow to Orange Solid |
| Shelf Life | As supplied, 2 years from the QC date provided on the Certificate of Analysis, when stored properly |
| Storage | Store at 2-8°C |